C9H15N5O — CID 99836088
1-(3-methylbut-2-enyl)-3-(2-methyl-1,2,4-triazol-3-yl)urea (PubChem CID 99836088) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 1-(3-methylbut-2-enyl)-3-(2-methyl-1,2,4-triazol-3-yl)urea.
| Compound Name | 1-(3-methylbut-2-enyl)-3-(2-methyl-1,2,4-triazol-3-yl)urea |
|---|---|
| PubChem CID | 99836088 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 1-(3-methylbut-2-enyl)-3-(2-methyl-1,2,4-triazol-3-yl)urea |
| SMILES | CC(C)=CCNC(=O)Nc1ncnn1C |
| InChI | InChI=1S/C9H15N5O/c1-7(2)4-5-10-9(15)13-8-11-6-12-14(8)3/h4,6H,5H2,1-3H3,(H2,10,11,12,13,15) |
| InChIKey | MDGXSLLJKBDEDP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|