About 1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)sulfonyl]-4-(triazol-1-ylmethyl)piperidine
1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)sulfonyl]-4-(triazol-1-ylmethyl)piperidine (PubChem CID 99836947) has the molecular formula C18H24N4O3S
and a molecular weight of 376.48 g/mol. Its IUPAC name is 1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)sulfonyl]-4-(triazol-1-ylmethyl)piperidine.
Molecular Properties
| Compound Name | 1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)sulfonyl]-4-(triazol-1-ylmethyl)piperidine |
| PubChem CID | 99836947 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)sulfonyl]-4-(triazol-1-ylmethyl)piperidine |
| SMILES | CC1(C)Cc2cccc(S(=O)(=O)N3CCC(Cn4ccnn4)CC3)c2O1 |
| InChI | InChI=1S/C18H24N4O3S/c1-18(2)12-15-4-3-5-16(17(15)25-18)26(23,24)22-9-6-14(7-10-22)13-21-11-8-19-20-21/h3-5,8,11,14H,6-7,9-10,12-13H2,1-2H3 |
| InChIKey | MRCHFLCDJSAOJM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)sulfonyl]-4-(triazol-1-ylmethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)sulfonyl]-4-(triazol-1-ylmethyl)piperidine?
The IUPAC name of 1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)sulfonyl]-4-(triazol-1-ylmethyl)piperidine (CID 99836947) is 1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)sulfonyl]-4-(triazol-1-ylmethyl)piperidine.
What is the SMILES notation for 1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)sulfonyl]-4-(triazol-1-ylmethyl)piperidine?
The canonical SMILES for 1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)sulfonyl]-4-(triazol-1-ylmethyl)piperidine is CC1(C)Cc2cccc(S(=O)(=O)N3CCC(Cn4ccnn4)CC3)c2O1.
What is the InChIKey of 1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)sulfonyl]-4-(triazol-1-ylmethyl)piperidine?
The InChIKey is MRCHFLCDJSAOJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O3S/c1-18(2)12-15-4-3-5-16(17(15)25-18)26(23,24)22-9-6-14(7-10-22)13-21-11-8-19-20-21/h3-5,8,11,14H,6-7,9-10,12-13H2,1-2H3.
What are the key properties of 1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)sulfonyl]-4-(triazol-1-ylmethyl)piperidine?
1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)sulfonyl]-4-(triazol-1-ylmethyl)piperidine has a molecular weight of 376.48 g/mol, XLogP of 2.09, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)sulfonyl]-4-(triazol-1-ylmethyl)piperidine is sourced from PubChem (CID 99836947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).