About N-[(1S)-1-cyclobutylethyl]-3-(1-methyl-1,2,4-triazol-3-yl)aniline
N-[(1S)-1-cyclobutylethyl]-3-(1-methyl-1,2,4-triazol-3-yl)aniline (PubChem CID 99837101) has the molecular formula C15H20N4
and a molecular weight of 256.35 g/mol. Its IUPAC name is N-[(1S)-1-cyclobutylethyl]-3-(1-methyl-1,2,4-triazol-3-yl)aniline.
Molecular Properties
| Compound Name | N-[(1S)-1-cyclobutylethyl]-3-(1-methyl-1,2,4-triazol-3-yl)aniline |
| PubChem CID | 99837101 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | N-[(1S)-1-cyclobutylethyl]-3-(1-methyl-1,2,4-triazol-3-yl)aniline |
| SMILES | C[C@H](Nc1cccc(-c2ncn(C)n2)c1)C1CCC1 |
| InChI | InChI=1S/C15H20N4/c1-11(12-5-3-6-12)17-14-8-4-7-13(9-14)15-16-10-19(2)18-15/h4,7-12,17H,3,5-6H2,1-2H3/t11-/m0/s1 |
| InChIKey | GJAIKWLXGNLPNS-NSHDSACASA-N |
| XLogP | 3.08 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1S)-1-cyclobutylethyl]-3-(1-methyl-1,2,4-triazol-3-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-cyclobutylethyl]-3-(1-methyl-1,2,4-triazol-3-yl)aniline?
The IUPAC name of N-[(1S)-1-cyclobutylethyl]-3-(1-methyl-1,2,4-triazol-3-yl)aniline (CID 99837101) is N-[(1S)-1-cyclobutylethyl]-3-(1-methyl-1,2,4-triazol-3-yl)aniline.
What is the SMILES notation for N-[(1S)-1-cyclobutylethyl]-3-(1-methyl-1,2,4-triazol-3-yl)aniline?
The canonical SMILES for N-[(1S)-1-cyclobutylethyl]-3-(1-methyl-1,2,4-triazol-3-yl)aniline is C[C@H](Nc1cccc(-c2ncn(C)n2)c1)C1CCC1.
What is the InChIKey of N-[(1S)-1-cyclobutylethyl]-3-(1-methyl-1,2,4-triazol-3-yl)aniline?
The InChIKey is GJAIKWLXGNLPNS-NSHDSACASA-N. The full InChI is InChI=1S/C15H20N4/c1-11(12-5-3-6-12)17-14-8-4-7-13(9-14)15-16-10-19(2)18-15/h4,7-12,17H,3,5-6H2,1-2H3/t11-/m0/s1.
What are the key properties of N-[(1S)-1-cyclobutylethyl]-3-(1-methyl-1,2,4-triazol-3-yl)aniline?
N-[(1S)-1-cyclobutylethyl]-3-(1-methyl-1,2,4-triazol-3-yl)aniline has a molecular weight of 256.35 g/mol, XLogP of 3.08, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-cyclobutylethyl]-3-(1-methyl-1,2,4-triazol-3-yl)aniline is sourced from PubChem (CID 99837101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).