C18H26N2O2S — CID 99837390
(1R,5S,7R)-4-[(2,6-dimethyl-3-pyridinyl)methyl]-10,10-dimethyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide (PubChem CID 99837390) has the molecular formula C18H26N2O2S and a molecular weight of 334.49 g/mol. Its IUPAC name is (1R,5S,7R)-4-[(2,6-dimethyl-3-pyridinyl)methyl]-10,10-dimethyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide.
| Compound Name | (1R,5S,7R)-4-[(2,6-dimethyl-3-pyridinyl)methyl]-10,10-dimethyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide |
|---|---|
| PubChem CID | 99837390 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (1R,5S,7R)-4-[(2,6-dimethyl-3-pyridinyl)methyl]-10,10-dimethyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide |
| SMILES | Cc1ccc(CN2[C@H]3C[C@H]4CC[C@@]3(CS2(=O)=O)C4(C)C)c(C)n1 |
| InChI | InChI=1S/C18H26N2O2S/c1-12-5-6-14(13(2)19-12)10-20-16-9-15-7-8-18(16,17(15,3)4)11-23(20,21)22/h5-6,15-16H,7-11H2,1-4H3/t15-,16+,18+/m1/s1 |
| InChIKey | OXNIVBYATUZWTR-RYRKJORJSA-N |
| XLogP | 3.04 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |