C15H12F2N4O2 — CID 99838182
3-[[5-[(1R,2R)-2-(2,4-difluorophenyl)cyclopropyl]-1,2,4-oxadiazol-3-yl]methyl]-5-methyl-1,2,4-oxadiazole (PubChem CID 99838182) has the molecular formula C15H12F2N4O2 and a molecular weight of 318.28 g/mol. Its IUPAC name is 3-[[5-[(1R,2R)-2-(2,4-difluorophenyl)cyclopropyl]-1,2,4-oxadiazol-3-yl]methyl]-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-[[5-[(1R,2R)-2-(2,4-difluorophenyl)cyclopropyl]-1,2,4-oxadiazol-3-yl]methyl]-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 99838182 |
| Molecular Formula | C15H12F2N4O2 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 3-[[5-[(1R,2R)-2-(2,4-difluorophenyl)cyclopropyl]-1,2,4-oxadiazol-3-yl]methyl]-5-methyl-1,2,4-oxadiazole |
| SMILES | Cc1nc(Cc2noc([C@@H]3C[C@H]3c3ccc(F)cc3F)n2)no1 |
| InChI | InChI=1S/C15H12F2N4O2/c1-7-18-13(20-22-7)6-14-19-15(23-21-14)11-5-10(11)9-3-2-8(16)4-12(9)17/h2-4,10-11H,5-6H2,1H3/t10-,11+/m0/s1 |
| InChIKey | KDYRSNUIGKKJGD-WDEREUQCSA-N |
| XLogP | 2.90 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |