C17H24N4 — CID 99838451
(4S)-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-phenylazepane (PubChem CID 99838451) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is (4S)-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-phenylazepane.
| Compound Name | (4S)-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-phenylazepane |
|---|---|
| PubChem CID | 99838451 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (4S)-1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-phenylazepane |
| SMILES | CCn1ncnc1CN1CCC[C@H](c2ccccc2)CC1 |
| InChI | InChI=1S/C17H24N4/c1-2-21-17(18-14-19-21)13-20-11-6-9-16(10-12-20)15-7-4-3-5-8-15/h3-5,7-8,14,16H,2,6,9-13H2,1H3/t16-/m0/s1 |
| InChIKey | SAPXZNBBNGWETB-INIZCTEOSA-N |
| XLogP | 3.07 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |