C13H26N2O4S2 — CID 99838599
N,N'-dicyclopropyl-N,N'-diethylpropane-1,3-disulfonamide (PubChem CID 99838599) has the molecular formula C13H26N2O4S2 and a molecular weight of 338.50 g/mol. Its IUPAC name is N,N'-dicyclopropyl-N,N'-diethylpropane-1,3-disulfonamide.
| Compound Name | N,N'-dicyclopropyl-N,N'-diethylpropane-1,3-disulfonamide |
|---|---|
| PubChem CID | 99838599 |
| Molecular Formula | C13H26N2O4S2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N,N'-dicyclopropyl-N,N'-diethylpropane-1,3-disulfonamide |
| SMILES | CCN(C1CC1)S(=O)(=O)CCCS(=O)(=O)N(CC)C1CC1 |
| InChI | InChI=1S/C13H26N2O4S2/c1-3-14(12-6-7-12)20(16,17)10-5-11-21(18,19)15(4-2)13-8-9-13/h12-13H,3-11H2,1-2H3 |
| InChIKey | UJKKBHVNPREASF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |