C16H18FN3O — CID 99839093
4-[[(3R)-3-(3-fluorophenoxy)pyrrolidin-1-yl]methyl]pyridin-2-amine (PubChem CID 99839093) has the molecular formula C16H18FN3O and a molecular weight of 287.34 g/mol. Its IUPAC name is 4-[[(3R)-3-(3-fluorophenoxy)pyrrolidin-1-yl]methyl]pyridin-2-amine.
| Compound Name | 4-[[(3R)-3-(3-fluorophenoxy)pyrrolidin-1-yl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 99839093 |
| Molecular Formula | C16H18FN3O |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 4-[[(3R)-3-(3-fluorophenoxy)pyrrolidin-1-yl]methyl]pyridin-2-amine |
| SMILES | Nc1cc(CN2CC[C@@H](Oc3cccc(F)c3)C2)ccn1 |
| InChI | InChI=1S/C16H18FN3O/c17-13-2-1-3-14(9-13)21-15-5-7-20(11-15)10-12-4-6-19-16(18)8-12/h1-4,6,8-9,15H,5,7,10-11H2,(H2,18,19)/t15-/m1/s1 |
| InChIKey | CSRKZTGXZBECET-OAHLLOKOSA-N |
| XLogP | 2.46 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |