C15H12N2OS — CID 99839545
2-[2-(pyridin-3-ylmethoxy)phenyl]-1,3-thiazole (PubChem CID 99839545) has the molecular formula C15H12N2OS and a molecular weight of 268.34 g/mol. Its IUPAC name is 2-[2-(pyridin-3-ylmethoxy)phenyl]-1,3-thiazole.
| Compound Name | 2-[2-(pyridin-3-ylmethoxy)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 99839545 |
| Molecular Formula | C15H12N2OS |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-[2-(pyridin-3-ylmethoxy)phenyl]-1,3-thiazole |
| SMILES | c1cncc(COc2ccccc2-c2nccs2)c1 |
| InChI | InChI=1S/C15H12N2OS/c1-2-6-14(13(5-1)15-17-8-9-19-15)18-11-12-4-3-7-16-10-12/h1-10H,11H2 |
| InChIKey | FJLRNRUHNPRHMN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |