C12H22N2O — CID 99840092
2,2-dimethyl-N-[(2S)-pent-4-en-2-yl]pyrrolidine-1-carboxamide (PubChem CID 99840092) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(2S)-pent-4-en-2-yl]pyrrolidine-1-carboxamide.
| Compound Name | 2,2-dimethyl-N-[(2S)-pent-4-en-2-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 99840092 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 2,2-dimethyl-N-[(2S)-pent-4-en-2-yl]pyrrolidine-1-carboxamide |
| SMILES | C=CC[C@H](C)NC(=O)N1CCCC1(C)C |
| InChI | InChI=1S/C12H22N2O/c1-5-7-10(2)13-11(15)14-9-6-8-12(14,3)4/h5,10H,1,6-9H2,2-4H3,(H,13,15)/t10-/m0/s1 |
| InChIKey | NONDIHFPIITJLK-JTQLQIEISA-N |
| XLogP | 2.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|