C7H7F6N3OS — CID 99841599
4-(2,2,2-trifluoroethyl)-3-[2-(trifluoromethoxy)ethylsulfanyl]-1,2,4-triazole (PubChem CID 99841599) has the molecular formula C7H7F6N3OS and a molecular weight of 295.21 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethyl)-3-[2-(trifluoromethoxy)ethylsulfanyl]-1,2,4-triazole.
| Compound Name | 4-(2,2,2-trifluoroethyl)-3-[2-(trifluoromethoxy)ethylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 99841599 |
| Molecular Formula | C7H7F6N3OS |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 4-(2,2,2-trifluoroethyl)-3-[2-(trifluoromethoxy)ethylsulfanyl]-1,2,4-triazole |
| SMILES | FC(F)(F)Cn1cnnc1SCCOC(F)(F)F |
| InChI | InChI=1S/C7H7F6N3OS/c8-6(9,10)3-16-4-14-15-5(16)18-2-1-17-7(11,12)13/h4H,1-3H2 |
| InChIKey | PZKNIWIAGFHHKC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|