About (2S)-2,4-dimethyl-N-(4-methylpyrimidin-2-yl)pent-4-enamide
(2S)-2,4-dimethyl-N-(4-methylpyrimidin-2-yl)pent-4-enamide (PubChem CID 99842137) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is (2S)-2,4-dimethyl-N-(4-methylpyrimidin-2-yl)pent-4-enamide.
Molecular Properties
| Compound Name | (2S)-2,4-dimethyl-N-(4-methylpyrimidin-2-yl)pent-4-enamide |
| PubChem CID | 99842137 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (2S)-2,4-dimethyl-N-(4-methylpyrimidin-2-yl)pent-4-enamide |
| SMILES | C=C(C)C[C@H](C)C(=O)Nc1nccc(C)n1 |
| InChI | InChI=1S/C12H17N3O/c1-8(2)7-9(3)11(16)15-12-13-6-5-10(4)14-12/h5-6,9H,1,7H2,2-4H3,(H,13,14,15,16)/t9-/m0/s1 |
| InChIKey | OFZXASPCBZYVHD-VIFPVBQESA-N |
| XLogP | 2.33 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,4-dimethyl-N-(4-methylpyrimidin-2-yl)pent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,4-dimethyl-N-(4-methylpyrimidin-2-yl)pent-4-enamide?
The IUPAC name of (2S)-2,4-dimethyl-N-(4-methylpyrimidin-2-yl)pent-4-enamide (CID 99842137) is (2S)-2,4-dimethyl-N-(4-methylpyrimidin-2-yl)pent-4-enamide.
What is the SMILES notation for (2S)-2,4-dimethyl-N-(4-methylpyrimidin-2-yl)pent-4-enamide?
The canonical SMILES for (2S)-2,4-dimethyl-N-(4-methylpyrimidin-2-yl)pent-4-enamide is C=C(C)C[C@H](C)C(=O)Nc1nccc(C)n1.
What is the InChIKey of (2S)-2,4-dimethyl-N-(4-methylpyrimidin-2-yl)pent-4-enamide?
The InChIKey is OFZXASPCBZYVHD-VIFPVBQESA-N. The full InChI is InChI=1S/C12H17N3O/c1-8(2)7-9(3)11(16)15-12-13-6-5-10(4)14-12/h5-6,9H,1,7H2,2-4H3,(H,13,14,15,16)/t9-/m0/s1.
What are the key properties of (2S)-2,4-dimethyl-N-(4-methylpyrimidin-2-yl)pent-4-enamide?
(2S)-2,4-dimethyl-N-(4-methylpyrimidin-2-yl)pent-4-enamide has a molecular weight of 219.29 g/mol, XLogP of 2.33, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,4-dimethyl-N-(4-methylpyrimidin-2-yl)pent-4-enamide is sourced from PubChem (CID 99842137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).