About N-[(3R)-1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2,2-difluoroacetamide
N-[(3R)-1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2,2-difluoroacetamide (PubChem CID 99842219) has the molecular formula C14H14F4N2O3
and a molecular weight of 334.27 g/mol. Its IUPAC name is N-[(3R)-1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N-[(3R)-1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2,2-difluoroacetamide |
| PubChem CID | 99842219 |
| Molecular Formula | C14H14F4N2O3 |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N-[(3R)-1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2,2-difluoroacetamide |
| SMILES | O=C(N[C@@H]1CCCN(c2ccc(OC(F)F)cc2)C1=O)C(F)F |
| InChI | InChI=1S/C14H14F4N2O3/c15-11(16)12(21)19-10-2-1-7-20(13(10)22)8-3-5-9(6-4-8)23-14(17)18/h3-6,10-11,14H,1-2,7H2,(H,19,21)/t10-/m1/s1 |
| InChIKey | LNBIPCLMFMIHKJ-SNVBAGLBSA-N |
| XLogP | 2.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3R)-1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R)-1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2,2-difluoroacetamide?
The IUPAC name of N-[(3R)-1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2,2-difluoroacetamide (CID 99842219) is N-[(3R)-1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2,2-difluoroacetamide.
What is the SMILES notation for N-[(3R)-1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2,2-difluoroacetamide?
The canonical SMILES for N-[(3R)-1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2,2-difluoroacetamide is O=C(N[C@@H]1CCCN(c2ccc(OC(F)F)cc2)C1=O)C(F)F.
What is the InChIKey of N-[(3R)-1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2,2-difluoroacetamide?
The InChIKey is LNBIPCLMFMIHKJ-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H14F4N2O3/c15-11(16)12(21)19-10-2-1-7-20(13(10)22)8-3-5-9(6-4-8)23-14(17)18/h3-6,10-11,14H,1-2,7H2,(H,19,21)/t10-/m1/s1.
What are the key properties of N-[(3R)-1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2,2-difluoroacetamide?
N-[(3R)-1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2,2-difluoroacetamide has a molecular weight of 334.27 g/mol, XLogP of 2.16, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R)-1-[4-(difluoromethoxy)phenyl]-2-oxopiperidin-3-yl]-2,2-difluoroacetamide is sourced from PubChem (CID 99842219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).