About ethyl (3R)-1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylate
ethyl (3R)-1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylate (PubChem CID 99842676) has the molecular formula C15H24N2O3
and a molecular weight of 280.37 g/mol. Its IUPAC name is ethyl (3R)-1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl (3R)-1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylate |
| PubChem CID | 99842676 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | ethyl (3R)-1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C(C)C)CCN(Cc2ncc(C)o2)C1 |
| InChI | InChI=1S/C15H24N2O3/c1-5-19-14(18)15(11(2)3)6-7-17(10-15)9-13-16-8-12(4)20-13/h8,11H,5-7,9-10H2,1-4H3/t15-/m0/s1 |
| InChIKey | QJYGRHASIPPJQV-HNNXBMFYSA-N |
| XLogP | 2.39 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (3R)-1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3R)-1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylate?
The IUPAC name of ethyl (3R)-1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylate (CID 99842676) is ethyl (3R)-1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylate.
What is the SMILES notation for ethyl (3R)-1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylate?
The canonical SMILES for ethyl (3R)-1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylate is CCOC(=O)[C@@]1(C(C)C)CCN(Cc2ncc(C)o2)C1.
What is the InChIKey of ethyl (3R)-1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylate?
The InChIKey is QJYGRHASIPPJQV-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H24N2O3/c1-5-19-14(18)15(11(2)3)6-7-17(10-15)9-13-16-8-12(4)20-13/h8,11H,5-7,9-10H2,1-4H3/t15-/m0/s1.
What are the key properties of ethyl (3R)-1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylate?
ethyl (3R)-1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylate has a molecular weight of 280.37 g/mol, XLogP of 2.39, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3R)-1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-propan-2-ylpyrrolidine-3-carboxylate is sourced from PubChem (CID 99842676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).