C14H18F3N5O2 — CID 99843539
(3S)-3-[4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]-1-(2,2,2-trifluoroethyl)pyrrolidine-2,5-dione (PubChem CID 99843539) has the molecular formula C14H18F3N5O2 and a molecular weight of 345.33 g/mol. Its IUPAC name is (3S)-3-[4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]-1-(2,2,2-trifluoroethyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]-1-(2,2,2-trifluoroethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 99843539 |
| Molecular Formula | C14H18F3N5O2 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (3S)-3-[4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]-1-(2,2,2-trifluoroethyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](N2CCC(Cn3cncn3)CC2)C(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C14H18F3N5O2/c15-14(16,17)7-22-12(23)5-11(13(22)24)20-3-1-10(2-4-20)6-21-9-18-8-19-21/h8-11H,1-7H2/t11-/m0/s1 |
| InChIKey | SQSBHUTVYXMZRY-NSHDSACASA-N |
| XLogP | 0.68 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|