C17H24N4O2S2 — CID 99844030
4-propan-2-yl-2-[4-(2-thiophen-2-ylethylsulfonyl)piperazin-1-yl]pyrimidine (PubChem CID 99844030) has the molecular formula C17H24N4O2S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 4-propan-2-yl-2-[4-(2-thiophen-2-ylethylsulfonyl)piperazin-1-yl]pyrimidine.
| Compound Name | 4-propan-2-yl-2-[4-(2-thiophen-2-ylethylsulfonyl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 99844030 |
| Molecular Formula | C17H24N4O2S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 4-propan-2-yl-2-[4-(2-thiophen-2-ylethylsulfonyl)piperazin-1-yl]pyrimidine |
| SMILES | CC(C)c1ccnc(N2CCN(S(=O)(=O)CCc3cccs3)CC2)n1 |
| InChI | InChI=1S/C17H24N4O2S2/c1-14(2)16-5-7-18-17(19-16)20-8-10-21(11-9-20)25(22,23)13-6-15-4-3-12-24-15/h3-5,7,12,14H,6,8-11,13H2,1-2H3 |
| InChIKey | ZOBWFOITMKTHSN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |