About 6-acetyl-2-[(1-phenyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one
6-acetyl-2-[(1-phenyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one (PubChem CID 99844192) has the molecular formula C15H13N5O2
and a molecular weight of 295.30 g/mol. Its IUPAC name is 6-acetyl-2-[(1-phenyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 6-acetyl-2-[(1-phenyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one |
| PubChem CID | 99844192 |
| Molecular Formula | C15H13N5O2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 6-acetyl-2-[(1-phenyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one |
| SMILES | CC(=O)c1ccc(=O)n(Cc2ncn(-c3ccccc3)n2)n1 |
| InChI | InChI=1S/C15H13N5O2/c1-11(21)13-7-8-15(22)19(17-13)9-14-16-10-20(18-14)12-5-3-2-4-6-12/h2-8,10H,9H2,1H3 |
| InChIKey | QJJZQIAKRKEHPH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 82.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-acetyl-2-[(1-phenyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetyl-2-[(1-phenyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one?
The IUPAC name of 6-acetyl-2-[(1-phenyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one (CID 99844192) is 6-acetyl-2-[(1-phenyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one.
What is the SMILES notation for 6-acetyl-2-[(1-phenyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one?
The canonical SMILES for 6-acetyl-2-[(1-phenyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one is CC(=O)c1ccc(=O)n(Cc2ncn(-c3ccccc3)n2)n1.
What is the InChIKey of 6-acetyl-2-[(1-phenyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one?
The InChIKey is QJJZQIAKRKEHPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N5O2/c1-11(21)13-7-8-15(22)19(17-13)9-14-16-10-20(18-14)12-5-3-2-4-6-12/h2-8,10H,9H2,1H3.
What are the key properties of 6-acetyl-2-[(1-phenyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one?
6-acetyl-2-[(1-phenyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one has a molecular weight of 295.30 g/mol, XLogP of 1.07, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetyl-2-[(1-phenyl-1,2,4-triazol-3-yl)methyl]pyridazin-3-one is sourced from PubChem (CID 99844192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).