C23H34FN5OS — CID 99845408
(2S)-2-[[5-[(1S)-1-(dimethylamino)ethyl]-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]propanamide (PubChem CID 99845408) has the molecular formula C23H34FN5OS and a molecular weight of 447.62 g/mol. Its IUPAC name is (2S)-2-[[5-[(1S)-1-(dimethylamino)ethyl]-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]propanamide.
| Compound Name | (2S)-2-[[5-[(1S)-1-(dimethylamino)ethyl]-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 99845408 |
| Molecular Formula | C23H34FN5OS |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | (2S)-2-[[5-[(1S)-1-(dimethylamino)ethyl]-4-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]propanamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1NC(=O)[C@H](C)Sc1nnc([C@H](C)N(C)C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H34FN5OS/c1-14-8-7-9-20(15(14)2)25-22(30)17(4)31-23-27-26-21(16(3)28(5)6)29(23)19-12-10-18(24)11-13-19/h10-17,20H,7-9H2,1-6H3,(H,25,30)/t14-,15+,16+,17+,20-/m1/s1 |
| InChIKey | KWVQAKUXHIUMNS-ZPFYTHJMSA-N |
| XLogP | 4.45 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |