C12H23N3 — CID 99846005
2-[[(1S)-cyclohex-3-en-1-yl]methyl]-1,1,3,3-tetramethylguanidine (PubChem CID 99846005) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 2-[[(1S)-cyclohex-3-en-1-yl]methyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[[(1S)-cyclohex-3-en-1-yl]methyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 99846005 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 2-[[(1S)-cyclohex-3-en-1-yl]methyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=NC[C@@H]1CC=CCC1)N(C)C |
| InChI | InChI=1S/C12H23N3/c1-14(2)12(15(3)4)13-10-11-8-6-5-7-9-11/h5-6,11H,7-10H2,1-4H3/t11-/m1/s1 |
| InChIKey | SGJOCDJRJCNMTB-LLVKDONJSA-N |
| XLogP | 1.82 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|