C19H32N4OS — CID 99846130
1-[(3R)-3-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-2-[(1S,5R)-3,3,5-trimethylcyclohexyl]ethanone (PubChem CID 99846130) has the molecular formula C19H32N4OS and a molecular weight of 364.56 g/mol. Its IUPAC name is 1-[(3R)-3-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-2-[(1S,5R)-3,3,5-trimethylcyclohexyl]ethanone.
| Compound Name | 1-[(3R)-3-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-2-[(1S,5R)-3,3,5-trimethylcyclohexyl]ethanone |
|---|---|
| PubChem CID | 99846130 |
| Molecular Formula | C19H32N4OS |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 1-[(3R)-3-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-2-[(1S,5R)-3,3,5-trimethylcyclohexyl]ethanone |
| SMILES | C[C@@H]1C[C@H](CC(=O)N2CCC[C@@H](c3n[nH]c(=S)n3C)C2)CC(C)(C)C1 |
| InChI | InChI=1S/C19H32N4OS/c1-13-8-14(11-19(2,3)10-13)9-16(24)23-7-5-6-15(12-23)17-20-21-18(25)22(17)4/h13-15H,5-12H2,1-4H3,(H,21,25)/t13-,14-,15-/m1/s1 |
| InChIKey | IXDMPSMIAGWLKX-RBSFLKMASA-N |
| XLogP | 4.04 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|