C18H27N3O3 — CID 99846460
methyl (1S,2R,3S,4S)-3-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 99846460) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is methyl (1S,2R,3S,4S)-3-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl (1S,2R,3S,4S)-3-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 99846460 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | methyl (1S,2R,3S,4S)-3-[3-(1,3,5-trimethylpyrazol-4-yl)propanoylamino]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2CC[C@@H](C2)[C@@H]1NC(=O)CCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C18H27N3O3/c1-10-14(11(2)21(3)20-10)7-8-15(22)19-17-13-6-5-12(9-13)16(17)18(23)24-4/h12-13,16-17H,5-9H2,1-4H3,(H,19,22)/t12-,13-,16+,17-/m0/s1 |
| InChIKey | AHEFIPFOLKKMTC-CLROSIBMSA-N |
| XLogP | 1.67 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |