C11H12BrNO — CID 99846566
(NE)-N-[(1S,2S,3S,5S,6R,7R,8S,9R,10S)-7-bromo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]hydroxylamine (PubChem CID 99846566) has the molecular formula C11H12BrNO and a molecular weight of 254.13 g/mol. Its IUPAC name is (NE)-N-[(1S,2S,3S,5S,6R,7R,8S,9R,10S)-7-bromo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1S,2S,3S,5S,6R,7R,8S,9R,10S)-7-bromo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]hydroxylamine |
|---|---|
| PubChem CID | 99846566 |
| Molecular Formula | C11H12BrNO |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | (NE)-N-[(1S,2S,3S,5S,6R,7R,8S,9R,10S)-7-bromo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]hydroxylamine |
| SMILES | O/N=C1/[C@H]2[C@H]3[C@@H]4C[C@@H]5[C@@H]3[C@@H](Br)[C@@H]2[C@@H]5[C@@H]14 |
| InChI | InChI=1S/C11H12BrNO/c12-10-6-2-1-3-4(6)9-8(10)5(2)7(3)11(9)13-14/h2-10,14H,1H2/b13-11+/t2-,3-,4-,5-,6-,7-,8+,9-,10+/m0/s1 |
| InChIKey | FLIVZDHPXLXDIL-GTGGMNDSSA-N |
| XLogP | 1.97 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|