About 5,6-dimethyl-3-[(2R,6S)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]pyridazine-4-carbonitrile
5,6-dimethyl-3-[(2R,6S)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]pyridazine-4-carbonitrile (PubChem CID 99848889) has the molecular formula C16H18N4OS
and a molecular weight of 314.41 g/mol. Its IUPAC name is 5,6-dimethyl-3-[(2R,6S)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]pyridazine-4-carbonitrile.
Molecular Properties
| Compound Name | 5,6-dimethyl-3-[(2R,6S)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]pyridazine-4-carbonitrile |
| PubChem CID | 99848889 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 5,6-dimethyl-3-[(2R,6S)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]pyridazine-4-carbonitrile |
| SMILES | Cc1nnc(N2C[C@@H](C)O[C@@H](c3ccsc3)C2)c(C#N)c1C |
| InChI | InChI=1S/C16H18N4OS/c1-10-7-20(8-15(21-10)13-4-5-22-9-13)16-14(6-17)11(2)12(3)18-19-16/h4-5,9-10,15H,7-8H2,1-3H3/t10-,15-/m1/s1 |
| InChIKey | XXAUJLFZBYDVLU-MEBBXXQBSA-N |
| XLogP | 2.99 |
| TPSA | 62.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,6-dimethyl-3-[(2R,6S)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]pyridazine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-3-[(2R,6S)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]pyridazine-4-carbonitrile?
The IUPAC name of 5,6-dimethyl-3-[(2R,6S)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]pyridazine-4-carbonitrile (CID 99848889) is 5,6-dimethyl-3-[(2R,6S)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]pyridazine-4-carbonitrile.
What is the SMILES notation for 5,6-dimethyl-3-[(2R,6S)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]pyridazine-4-carbonitrile?
The canonical SMILES for 5,6-dimethyl-3-[(2R,6S)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]pyridazine-4-carbonitrile is Cc1nnc(N2C[C@@H](C)O[C@@H](c3ccsc3)C2)c(C#N)c1C.
What is the InChIKey of 5,6-dimethyl-3-[(2R,6S)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]pyridazine-4-carbonitrile?
The InChIKey is XXAUJLFZBYDVLU-MEBBXXQBSA-N. The full InChI is InChI=1S/C16H18N4OS/c1-10-7-20(8-15(21-10)13-4-5-22-9-13)16-14(6-17)11(2)12(3)18-19-16/h4-5,9-10,15H,7-8H2,1-3H3/t10-,15-/m1/s1.
What are the key properties of 5,6-dimethyl-3-[(2R,6S)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]pyridazine-4-carbonitrile?
5,6-dimethyl-3-[(2R,6S)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]pyridazine-4-carbonitrile has a molecular weight of 314.41 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-3-[(2R,6S)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]pyridazine-4-carbonitrile is sourced from PubChem (CID 99848889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).