About N-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-3-fluoropropane-1-sulfonamide
N-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-3-fluoropropane-1-sulfonamide (PubChem CID 99848916) has the molecular formula C13H27FN2O2S
and a molecular weight of 294.44 g/mol. Its IUPAC name is N-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-3-fluoropropane-1-sulfonamide.
Molecular Properties
| Compound Name | N-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-3-fluoropropane-1-sulfonamide |
| PubChem CID | 99848916 |
| Molecular Formula | C13H27FN2O2S |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | N-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-3-fluoropropane-1-sulfonamide |
| SMILES | C[C@@H]1C[C@@H](C)CN(C[C@H](C)NS(=O)(=O)CCCF)C1 |
| InChI | InChI=1S/C13H27FN2O2S/c1-11-7-12(2)9-16(8-11)10-13(3)15-19(17,18)6-4-5-14/h11-13,15H,4-10H2,1-3H3/t11-,12-,13+/m1/s1 |
| InChIKey | OBEDVIDFJCQIIR-UPJWGTAASA-N |
| XLogP | 1.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-3-fluoropropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-3-fluoropropane-1-sulfonamide?
The IUPAC name of N-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-3-fluoropropane-1-sulfonamide (CID 99848916) is N-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-3-fluoropropane-1-sulfonamide.
What is the SMILES notation for N-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-3-fluoropropane-1-sulfonamide?
The canonical SMILES for N-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-3-fluoropropane-1-sulfonamide is C[C@@H]1C[C@@H](C)CN(C[C@H](C)NS(=O)(=O)CCCF)C1.
What is the InChIKey of N-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-3-fluoropropane-1-sulfonamide?
The InChIKey is OBEDVIDFJCQIIR-UPJWGTAASA-N. The full InChI is InChI=1S/C13H27FN2O2S/c1-11-7-12(2)9-16(8-11)10-13(3)15-19(17,18)6-4-5-14/h11-13,15H,4-10H2,1-3H3/t11-,12-,13+/m1/s1.
What are the key properties of N-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-3-fluoropropane-1-sulfonamide?
N-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-3-fluoropropane-1-sulfonamide has a molecular weight of 294.44 g/mol, XLogP of 1.63, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propan-2-yl]-3-fluoropropane-1-sulfonamide is sourced from PubChem (CID 99848916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).