C14H22N2OS — CID 99849723
1-[(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-3-thiophen-2-ylpropan-1-one (PubChem CID 99849723) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 1-[(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-3-thiophen-2-ylpropan-1-one.
| Compound Name | 1-[(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-3-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 99849723 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-[(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-3-thiophen-2-ylpropan-1-one |
| SMILES | C[C@@H](N)[C@@H]1CCCN(C(=O)CCc2cccs2)C1 |
| InChI | InChI=1S/C14H22N2OS/c1-11(15)12-4-2-8-16(10-12)14(17)7-6-13-5-3-9-18-13/h3,5,9,11-12H,2,4,6-8,10,15H2,1H3/t11-,12-/m1/s1 |
| InChIKey | PLFHQPHLEVKKLH-VXGBXAGGSA-N |
| XLogP | 2.27 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |