About 3-ethyl-2-[(1-ethylcyclobutyl)methyl]-1,1-dimethylguanidine
3-ethyl-2-[(1-ethylcyclobutyl)methyl]-1,1-dimethylguanidine (PubChem CID 99850542) has the molecular formula C12H25N3
and a molecular weight of 211.35 g/mol. Its IUPAC name is 3-ethyl-2-[(1-ethylcyclobutyl)methyl]-1,1-dimethylguanidine.
Molecular Properties
| Compound Name | 3-ethyl-2-[(1-ethylcyclobutyl)methyl]-1,1-dimethylguanidine |
| PubChem CID | 99850542 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 3-ethyl-2-[(1-ethylcyclobutyl)methyl]-1,1-dimethylguanidine |
| SMILES | CCN/C(=N/CC1(CC)CCC1)N(C)C |
| InChI | InChI=1S/C12H25N3/c1-5-12(8-7-9-12)10-14-11(13-6-2)15(3)4/h5-10H2,1-4H3,(H,13,14) |
| InChIKey | LLFUQPBCKJHUTA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2-[(1-ethylcyclobutyl)methyl]-1,1-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-[(1-ethylcyclobutyl)methyl]-1,1-dimethylguanidine?
The IUPAC name of 3-ethyl-2-[(1-ethylcyclobutyl)methyl]-1,1-dimethylguanidine (CID 99850542) is 3-ethyl-2-[(1-ethylcyclobutyl)methyl]-1,1-dimethylguanidine.
What is the SMILES notation for 3-ethyl-2-[(1-ethylcyclobutyl)methyl]-1,1-dimethylguanidine?
The canonical SMILES for 3-ethyl-2-[(1-ethylcyclobutyl)methyl]-1,1-dimethylguanidine is CCN/C(=N/CC1(CC)CCC1)N(C)C.
What is the InChIKey of 3-ethyl-2-[(1-ethylcyclobutyl)methyl]-1,1-dimethylguanidine?
The InChIKey is LLFUQPBCKJHUTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3/c1-5-12(8-7-9-12)10-14-11(13-6-2)15(3)4/h5-10H2,1-4H3,(H,13,14).
What are the key properties of 3-ethyl-2-[(1-ethylcyclobutyl)methyl]-1,1-dimethylguanidine?
3-ethyl-2-[(1-ethylcyclobutyl)methyl]-1,1-dimethylguanidine has a molecular weight of 211.35 g/mol, XLogP of 2.09, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-[(1-ethylcyclobutyl)methyl]-1,1-dimethylguanidine is sourced from PubChem (CID 99850542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).