C16H21N3O2 — CID 99850769
(2R)-N-(3-cyanophenyl)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propanamide (PubChem CID 99850769) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (2R)-N-(3-cyanophenyl)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propanamide.
| Compound Name | (2R)-N-(3-cyanophenyl)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propanamide |
|---|---|
| PubChem CID | 99850769 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (2R)-N-(3-cyanophenyl)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propanamide |
| SMILES | C[C@H](C(=O)Nc1cccc(C#N)c1)N1C[C@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C16H21N3O2/c1-11-9-19(10-12(2)21-11)13(3)16(20)18-15-6-4-5-14(7-15)8-17/h4-7,11-13H,9-10H2,1-3H3,(H,18,20)/t11-,12-,13+/m0/s1 |
| InChIKey | ACTAZYQDBWVAMB-RWMBFGLXSA-N |
| XLogP | 1.99 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |