C18H18N8 — CID 99851340
(1R)-N-[(1-phenyltetrazol-5-yl)methyl]-1-[4-(triazol-1-yl)phenyl]ethanamine (PubChem CID 99851340) has the molecular formula C18H18N8 and a molecular weight of 346.40 g/mol. Its IUPAC name is (1R)-N-[(1-phenyltetrazol-5-yl)methyl]-1-[4-(triazol-1-yl)phenyl]ethanamine.
| Compound Name | (1R)-N-[(1-phenyltetrazol-5-yl)methyl]-1-[4-(triazol-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 99851340 |
| Molecular Formula | C18H18N8 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (1R)-N-[(1-phenyltetrazol-5-yl)methyl]-1-[4-(triazol-1-yl)phenyl]ethanamine |
| SMILES | C[C@@H](NCc1nnnn1-c1ccccc1)c1ccc(-n2ccnn2)cc1 |
| InChI | InChI=1S/C18H18N8/c1-14(15-7-9-16(10-8-15)25-12-11-20-23-25)19-13-18-21-22-24-26(18)17-5-3-2-4-6-17/h2-12,14,19H,13H2,1H3/t14-/m1/s1 |
| InChIKey | WVCAEDIUUSRPOA-CQSZACIVSA-N |
| XLogP | 2.09 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |