C19H28N2O3 — CID 99853495
(3S,3aS,7aR)-N-[[2-(2-hydroxyethoxy)phenyl]methyl]-3-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide (PubChem CID 99853495) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is (3S,3aS,7aR)-N-[[2-(2-hydroxyethoxy)phenyl]methyl]-3-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide.
| Compound Name | (3S,3aS,7aR)-N-[[2-(2-hydroxyethoxy)phenyl]methyl]-3-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
|---|---|
| PubChem CID | 99853495 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (3S,3aS,7aR)-N-[[2-(2-hydroxyethoxy)phenyl]methyl]-3-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)NCc2ccccc2OCCO)[C@@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C19H28N2O3/c1-14-13-21(17-8-4-3-7-16(14)17)19(23)20-12-15-6-2-5-9-18(15)24-11-10-22/h2,5-6,9,14,16-17,22H,3-4,7-8,10-13H2,1H3,(H,20,23)/t14-,16+,17-/m1/s1 |
| InChIKey | QWMMBEOSNZQNNA-HYVNUMGLSA-N |
| XLogP | 2.78 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |