C14H16ClFN4O2 — CID 99853569
[(2R)-4-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]morpholin-2-yl]methanol (PubChem CID 99853569) has the molecular formula C14H16ClFN4O2 and a molecular weight of 326.76 g/mol. Its IUPAC name is [(2R)-4-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]morpholin-2-yl]methanol.
| Compound Name | [(2R)-4-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 99853569 |
| Molecular Formula | C14H16ClFN4O2 |
| Molecular Weight | 326.76 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | [(2R)-4-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]morpholin-2-yl]methanol |
| SMILES | OC[C@H]1CN(Cc2cn(-c3ccc(F)c(Cl)c3)nn2)CCO1 |
| InChI | InChI=1S/C14H16ClFN4O2/c15-13-5-11(1-2-14(13)16)20-7-10(17-18-20)6-19-3-4-22-12(8-19)9-21/h1-2,5,7,12,21H,3-4,6,8-9H2/t12-/m1/s1 |
| InChIKey | RTMFFCKTHHXBGL-GFCCVEGCSA-N |
| XLogP | 1.25 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.76 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |