C14H19F2NOS — CID 99853725
(1S,2S)-1-(3,4-difluorophenyl)-2-[[(3S)-thian-3-yl]amino]propan-1-ol (PubChem CID 99853725) has the molecular formula C14H19F2NOS and a molecular weight of 287.38 g/mol. Its IUPAC name is (1S,2S)-1-(3,4-difluorophenyl)-2-[[(3S)-thian-3-yl]amino]propan-1-ol.
| Compound Name | (1S,2S)-1-(3,4-difluorophenyl)-2-[[(3S)-thian-3-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 99853725 |
| Molecular Formula | C14H19F2NOS |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (1S,2S)-1-(3,4-difluorophenyl)-2-[[(3S)-thian-3-yl]amino]propan-1-ol |
| SMILES | C[C@H](N[C@H]1CCCSC1)[C@@H](O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H19F2NOS/c1-9(17-11-3-2-6-19-8-11)14(18)10-4-5-12(15)13(16)7-10/h4-5,7,9,11,14,17-18H,2-3,6,8H2,1H3/t9-,11-,14+/m0/s1 |
| InChIKey | SDBPWLJDPKPMAT-NURSFMCSSA-N |
| XLogP | 2.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |