C18H28N2O2 — CID 99854285
(1S)-1-(2-methylphenyl)-2-morpholin-4-yl-N-[[(2R)-oxolan-2-yl]methyl]ethanamine (PubChem CID 99854285) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is (1S)-1-(2-methylphenyl)-2-morpholin-4-yl-N-[[(2R)-oxolan-2-yl]methyl]ethanamine.
| Compound Name | (1S)-1-(2-methylphenyl)-2-morpholin-4-yl-N-[[(2R)-oxolan-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 99854285 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (1S)-1-(2-methylphenyl)-2-morpholin-4-yl-N-[[(2R)-oxolan-2-yl]methyl]ethanamine |
| SMILES | Cc1ccccc1[C@@H](CN1CCOCC1)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C18H28N2O2/c1-15-5-2-3-7-17(15)18(14-20-8-11-21-12-9-20)19-13-16-6-4-10-22-16/h2-3,5,7,16,18-19H,4,6,8-14H2,1H3/t16-,18-/m1/s1 |
| InChIKey | MMMAMPJRWUJNIL-SJLPKXTDSA-N |
| XLogP | 2.14 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |