About 7-[[(3R)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]amino]-4H-1,4-benzoxazin-3-one
7-[[(3R)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]amino]-4H-1,4-benzoxazin-3-one (PubChem CID 99854695) has the molecular formula C20H23N3O2
and a molecular weight of 337.42 g/mol. Its IUPAC name is 7-[[(3R)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]amino]-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 7-[[(3R)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]amino]-4H-1,4-benzoxazin-3-one |
| PubChem CID | 99854695 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 7-[[(3R)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]amino]-4H-1,4-benzoxazin-3-one |
| SMILES | C[C@H](c1ccccc1)N1CC[C@@H](Nc2ccc3c(c2)OCC(=O)N3)C1 |
| InChI | InChI=1S/C20H23N3O2/c1-14(15-5-3-2-4-6-15)23-10-9-17(12-23)21-16-7-8-18-19(11-16)25-13-20(24)22-18/h2-8,11,14,17,21H,9-10,12-13H2,1H3,(H,22,24)/t14-,17-/m1/s1 |
| InChIKey | CFERQOTZURSPBJ-RHSMWYFYSA-N |
| XLogP | 3.26 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-[[(3R)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]amino]-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[(3R)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]amino]-4H-1,4-benzoxazin-3-one?
The IUPAC name of 7-[[(3R)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]amino]-4H-1,4-benzoxazin-3-one (CID 99854695) is 7-[[(3R)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]amino]-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 7-[[(3R)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]amino]-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 7-[[(3R)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]amino]-4H-1,4-benzoxazin-3-one is C[C@H](c1ccccc1)N1CC[C@@H](Nc2ccc3c(c2)OCC(=O)N3)C1.
What is the InChIKey of 7-[[(3R)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]amino]-4H-1,4-benzoxazin-3-one?
The InChIKey is CFERQOTZURSPBJ-RHSMWYFYSA-N. The full InChI is InChI=1S/C20H23N3O2/c1-14(15-5-3-2-4-6-15)23-10-9-17(12-23)21-16-7-8-18-19(11-16)25-13-20(24)22-18/h2-8,11,14,17,21H,9-10,12-13H2,1H3,(H,22,24)/t14-,17-/m1/s1.
What are the key properties of 7-[[(3R)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]amino]-4H-1,4-benzoxazin-3-one?
7-[[(3R)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]amino]-4H-1,4-benzoxazin-3-one has a molecular weight of 337.42 g/mol, XLogP of 3.26, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[(3R)-1-[(1R)-1-phenylethyl]pyrrolidin-3-yl]amino]-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 99854695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).