C15H28N4OS — CID 99854970
2-[[(cyclopentylamino)-[[(3S)-thian-3-yl]amino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 99854970) has the molecular formula C15H28N4OS and a molecular weight of 312.48 g/mol. Its IUPAC name is 2-[[(cyclopentylamino)-[[(3S)-thian-3-yl]amino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(cyclopentylamino)-[[(3S)-thian-3-yl]amino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 99854970 |
| Molecular Formula | C15H28N4OS |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-[[(cyclopentylamino)-[[(3S)-thian-3-yl]amino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NC1CCCC1)N[C@H]1CCCSC1 |
| InChI | InChI=1S/C15H28N4OS/c1-19(2)14(20)10-16-15(17-12-6-3-4-7-12)18-13-8-5-9-21-11-13/h12-13H,3-11H2,1-2H3,(H2,16,17,18)/t13-/m0/s1 |
| InChIKey | VWKQMEYCZHFEDW-ZDUSSCGKSA-N |
| XLogP | 1.45 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|