About (3S)-1-[(3,6-dimethylpyrazin-2-yl)amino]-4-methylpentan-3-ol
(3S)-1-[(3,6-dimethylpyrazin-2-yl)amino]-4-methylpentan-3-ol (PubChem CID 99855079) has the molecular formula C12H21N3O
and a molecular weight of 223.32 g/mol. Its IUPAC name is (3S)-1-[(3,6-dimethylpyrazin-2-yl)amino]-4-methylpentan-3-ol.
Molecular Properties
| Compound Name | (3S)-1-[(3,6-dimethylpyrazin-2-yl)amino]-4-methylpentan-3-ol |
| PubChem CID | 99855079 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | (3S)-1-[(3,6-dimethylpyrazin-2-yl)amino]-4-methylpentan-3-ol |
| SMILES | Cc1cnc(C)c(NCC[C@H](O)C(C)C)n1 |
| InChI | InChI=1S/C12H21N3O/c1-8(2)11(16)5-6-13-12-10(4)14-7-9(3)15-12/h7-8,11,16H,5-6H2,1-4H3,(H,13,15)/t11-/m0/s1 |
| InChIKey | NXFKPTIMOKNLMG-NSHDSACASA-N |
| XLogP | 1.91 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-1-[(3,6-dimethylpyrazin-2-yl)amino]-4-methylpentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-[(3,6-dimethylpyrazin-2-yl)amino]-4-methylpentan-3-ol?
The IUPAC name of (3S)-1-[(3,6-dimethylpyrazin-2-yl)amino]-4-methylpentan-3-ol (CID 99855079) is (3S)-1-[(3,6-dimethylpyrazin-2-yl)amino]-4-methylpentan-3-ol.
What is the SMILES notation for (3S)-1-[(3,6-dimethylpyrazin-2-yl)amino]-4-methylpentan-3-ol?
The canonical SMILES for (3S)-1-[(3,6-dimethylpyrazin-2-yl)amino]-4-methylpentan-3-ol is Cc1cnc(C)c(NCC[C@H](O)C(C)C)n1.
What is the InChIKey of (3S)-1-[(3,6-dimethylpyrazin-2-yl)amino]-4-methylpentan-3-ol?
The InChIKey is NXFKPTIMOKNLMG-NSHDSACASA-N. The full InChI is InChI=1S/C12H21N3O/c1-8(2)11(16)5-6-13-12-10(4)14-7-9(3)15-12/h7-8,11,16H,5-6H2,1-4H3,(H,13,15)/t11-/m0/s1.
What are the key properties of (3S)-1-[(3,6-dimethylpyrazin-2-yl)amino]-4-methylpentan-3-ol?
(3S)-1-[(3,6-dimethylpyrazin-2-yl)amino]-4-methylpentan-3-ol has a molecular weight of 223.32 g/mol, XLogP of 1.91, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-[(3,6-dimethylpyrazin-2-yl)amino]-4-methylpentan-3-ol is sourced from PubChem (CID 99855079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).