About (2R)-4-[(6-methoxy-2,5-dimethylpyrimidin-4-yl)amino]butan-2-ol
(2R)-4-[(6-methoxy-2,5-dimethylpyrimidin-4-yl)amino]butan-2-ol (PubChem CID 99855921) has the molecular formula C11H19N3O2
and a molecular weight of 225.29 g/mol. Its IUPAC name is (2R)-4-[(6-methoxy-2,5-dimethylpyrimidin-4-yl)amino]butan-2-ol.
Molecular Properties
| Compound Name | (2R)-4-[(6-methoxy-2,5-dimethylpyrimidin-4-yl)amino]butan-2-ol |
| PubChem CID | 99855921 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | (2R)-4-[(6-methoxy-2,5-dimethylpyrimidin-4-yl)amino]butan-2-ol |
| SMILES | COc1nc(C)nc(NCC[C@@H](C)O)c1C |
| InChI | InChI=1S/C11H19N3O2/c1-7(15)5-6-12-10-8(2)11(16-4)14-9(3)13-10/h7,15H,5-6H2,1-4H3,(H,12,13,14)/t7-/m1/s1 |
| InChIKey | CESGZBXPUZCIBD-SSDOTTSWSA-N |
| XLogP | 1.28 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-4-[(6-methoxy-2,5-dimethylpyrimidin-4-yl)amino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-[(6-methoxy-2,5-dimethylpyrimidin-4-yl)amino]butan-2-ol?
The IUPAC name of (2R)-4-[(6-methoxy-2,5-dimethylpyrimidin-4-yl)amino]butan-2-ol (CID 99855921) is (2R)-4-[(6-methoxy-2,5-dimethylpyrimidin-4-yl)amino]butan-2-ol.
What is the SMILES notation for (2R)-4-[(6-methoxy-2,5-dimethylpyrimidin-4-yl)amino]butan-2-ol?
The canonical SMILES for (2R)-4-[(6-methoxy-2,5-dimethylpyrimidin-4-yl)amino]butan-2-ol is COc1nc(C)nc(NCC[C@@H](C)O)c1C.
What is the InChIKey of (2R)-4-[(6-methoxy-2,5-dimethylpyrimidin-4-yl)amino]butan-2-ol?
The InChIKey is CESGZBXPUZCIBD-SSDOTTSWSA-N. The full InChI is InChI=1S/C11H19N3O2/c1-7(15)5-6-12-10-8(2)11(16-4)14-9(3)13-10/h7,15H,5-6H2,1-4H3,(H,12,13,14)/t7-/m1/s1.
What are the key properties of (2R)-4-[(6-methoxy-2,5-dimethylpyrimidin-4-yl)amino]butan-2-ol?
(2R)-4-[(6-methoxy-2,5-dimethylpyrimidin-4-yl)amino]butan-2-ol has a molecular weight of 225.29 g/mol, XLogP of 1.28, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-[(6-methoxy-2,5-dimethylpyrimidin-4-yl)amino]butan-2-ol is sourced from PubChem (CID 99855921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).