About 1-[(1S,4R)-4-tert-butylcycloheptyl]-3-[[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]methyl]urea
1-[(1S,4R)-4-tert-butylcycloheptyl]-3-[[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]methyl]urea (PubChem CID 99856813) has the molecular formula C19H36N2O3
and a molecular weight of 340.51 g/mol. Its IUPAC name is 1-[(1S,4R)-4-tert-butylcycloheptyl]-3-[[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]methyl]urea.
Molecular Properties
| Compound Name | 1-[(1S,4R)-4-tert-butylcycloheptyl]-3-[[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]methyl]urea |
| PubChem CID | 99856813 |
| Molecular Formula | C19H36N2O3 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.27 |
| IUPAC Name | 1-[(1S,4R)-4-tert-butylcycloheptyl]-3-[[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]methyl]urea |
| SMILES | CC(C)(C)[C@@H]1CCC[C@H](NC(=O)NC[C@@]2(CCO)CCOC2)CC1 |
| InChI | InChI=1S/C19H36N2O3/c1-18(2,3)15-5-4-6-16(8-7-15)21-17(23)20-13-19(9-11-22)10-12-24-14-19/h15-16,22H,4-14H2,1-3H3,(H2,20,21,23)/t15-,16+,19-/m1/s1 |
| InChIKey | XKOQXIVMTPWFCD-JTDSTZFVSA-N |
| XLogP | 3.07 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1S,4R)-4-tert-butylcycloheptyl]-3-[[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,4R)-4-tert-butylcycloheptyl]-3-[[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]methyl]urea?
The IUPAC name of 1-[(1S,4R)-4-tert-butylcycloheptyl]-3-[[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]methyl]urea (CID 99856813) is 1-[(1S,4R)-4-tert-butylcycloheptyl]-3-[[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]methyl]urea.
What is the SMILES notation for 1-[(1S,4R)-4-tert-butylcycloheptyl]-3-[[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]methyl]urea?
The canonical SMILES for 1-[(1S,4R)-4-tert-butylcycloheptyl]-3-[[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]methyl]urea is CC(C)(C)[C@@H]1CCC[C@H](NC(=O)NC[C@@]2(CCO)CCOC2)CC1.
What is the InChIKey of 1-[(1S,4R)-4-tert-butylcycloheptyl]-3-[[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]methyl]urea?
The InChIKey is XKOQXIVMTPWFCD-JTDSTZFVSA-N. The full InChI is InChI=1S/C19H36N2O3/c1-18(2,3)15-5-4-6-16(8-7-15)21-17(23)20-13-19(9-11-22)10-12-24-14-19/h15-16,22H,4-14H2,1-3H3,(H2,20,21,23)/t15-,16+,19-/m1/s1.
What are the key properties of 1-[(1S,4R)-4-tert-butylcycloheptyl]-3-[[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]methyl]urea?
1-[(1S,4R)-4-tert-butylcycloheptyl]-3-[[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]methyl]urea has a molecular weight of 340.51 g/mol, XLogP of 3.07, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,4R)-4-tert-butylcycloheptyl]-3-[[(3R)-3-(2-hydroxyethyl)oxolan-3-yl]methyl]urea is sourced from PubChem (CID 99856813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).