C13H16F3NO3S — CID 99857548
(2R,3R)-2-methyl-N-[2-(3,4,5-trifluorophenyl)ethyl]oxolane-3-sulfonamide (PubChem CID 99857548) has the molecular formula C13H16F3NO3S and a molecular weight of 323.34 g/mol. Its IUPAC name is (2R,3R)-2-methyl-N-[2-(3,4,5-trifluorophenyl)ethyl]oxolane-3-sulfonamide.
| Compound Name | (2R,3R)-2-methyl-N-[2-(3,4,5-trifluorophenyl)ethyl]oxolane-3-sulfonamide |
|---|---|
| PubChem CID | 99857548 |
| Molecular Formula | C13H16F3NO3S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (2R,3R)-2-methyl-N-[2-(3,4,5-trifluorophenyl)ethyl]oxolane-3-sulfonamide |
| SMILES | C[C@H]1OCC[C@H]1S(=O)(=O)NCCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H16F3NO3S/c1-8-12(3-5-20-8)21(18,19)17-4-2-9-6-10(14)13(16)11(15)7-9/h6-8,12,17H,2-5H2,1H3/t8-,12-/m1/s1 |
| InChIKey | DUXDWJLBHCLDJB-PRHODGIISA-N |
| XLogP | 1.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|