C13H19N5OS — CID 99857817
3-(2-methoxyethyl)-N-[(6R)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-1,2,4-thiadiazol-5-amine (PubChem CID 99857817) has the molecular formula C13H19N5OS and a molecular weight of 293.40 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-N-[(6R)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(2-methoxyethyl)-N-[(6R)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 99857817 |
| Molecular Formula | C13H19N5OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 3-(2-methoxyethyl)-N-[(6R)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-1,2,4-thiadiazol-5-amine |
| SMILES | COCCc1nsc(N[C@@H]2CCc3nc(C)cn3C2)n1 |
| InChI | InChI=1S/C13H19N5OS/c1-9-7-18-8-10(3-4-12(18)14-9)15-13-16-11(17-20-13)5-6-19-2/h7,10H,3-6,8H2,1-2H3,(H,15,16,17)/t10-/m1/s1 |
| InChIKey | HMYMMMNRVFGDLF-SNVBAGLBSA-N |
| XLogP | 1.66 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |