About 2-[[(1R,2R)-2-hydroxycyclopentyl]amino]quinoline-4-carbonitrile
2-[[(1R,2R)-2-hydroxycyclopentyl]amino]quinoline-4-carbonitrile (PubChem CID 99857872) has the molecular formula C15H15N3O
and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-hydroxycyclopentyl]amino]quinoline-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[[(1R,2R)-2-hydroxycyclopentyl]amino]quinoline-4-carbonitrile |
| PubChem CID | 99857872 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-[[(1R,2R)-2-hydroxycyclopentyl]amino]quinoline-4-carbonitrile |
| SMILES | N#Cc1cc(N[C@@H]2CCC[C@H]2O)nc2ccccc12 |
| InChI | InChI=1S/C15H15N3O/c16-9-10-8-15(18-13-6-3-7-14(13)19)17-12-5-2-1-4-11(10)12/h1-2,4-5,8,13-14,19H,3,6-7H2,(H,17,18)/t13-,14-/m1/s1 |
| InChIKey | KVPPVSCVSQXJGY-ZIAGYGMSSA-N |
| XLogP | 2.43 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[(1R,2R)-2-hydroxycyclopentyl]amino]quinoline-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1R,2R)-2-hydroxycyclopentyl]amino]quinoline-4-carbonitrile?
The IUPAC name of 2-[[(1R,2R)-2-hydroxycyclopentyl]amino]quinoline-4-carbonitrile (CID 99857872) is 2-[[(1R,2R)-2-hydroxycyclopentyl]amino]quinoline-4-carbonitrile.
What is the SMILES notation for 2-[[(1R,2R)-2-hydroxycyclopentyl]amino]quinoline-4-carbonitrile?
The canonical SMILES for 2-[[(1R,2R)-2-hydroxycyclopentyl]amino]quinoline-4-carbonitrile is N#Cc1cc(N[C@@H]2CCC[C@H]2O)nc2ccccc12.
What is the InChIKey of 2-[[(1R,2R)-2-hydroxycyclopentyl]amino]quinoline-4-carbonitrile?
The InChIKey is KVPPVSCVSQXJGY-ZIAGYGMSSA-N. The full InChI is InChI=1S/C15H15N3O/c16-9-10-8-15(18-13-6-3-7-14(13)19)17-12-5-2-1-4-11(10)12/h1-2,4-5,8,13-14,19H,3,6-7H2,(H,17,18)/t13-,14-/m1/s1.
What are the key properties of 2-[[(1R,2R)-2-hydroxycyclopentyl]amino]quinoline-4-carbonitrile?
2-[[(1R,2R)-2-hydroxycyclopentyl]amino]quinoline-4-carbonitrile has a molecular weight of 253.30 g/mol, XLogP of 2.43, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1R,2R)-2-hydroxycyclopentyl]amino]quinoline-4-carbonitrile is sourced from PubChem (CID 99857872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).