C19H32N2O2 — CID 99857996
[1-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]piperidin-4-yl]-morpholin-4-ylmethanone (PubChem CID 99857996) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is [1-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]piperidin-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]piperidin-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 99857996 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | [1-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]piperidin-4-yl]-morpholin-4-ylmethanone |
| SMILES | CC1=CCC[C@H](C)[C@@H]1CN1CCC(C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C19H32N2O2/c1-15-4-3-5-16(2)18(15)14-20-8-6-17(7-9-20)19(22)21-10-12-23-13-11-21/h4,16-18H,3,5-14H2,1-2H3/t16-,18+/m0/s1 |
| InChIKey | CYWPNVHLTHTULL-FUHWJXTLSA-N |
| XLogP | 2.55 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|