C13H15F4NO3 — CID 99858229
(3aS,7aS)-2-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 99858229) has the molecular formula C13H15F4NO3 and a molecular weight of 309.26 g/mol. Its IUPAC name is (3aS,7aS)-2-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aS)-2-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 99858229 |
| Molecular Formula | C13H15F4NO3 |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (3aS,7aS)-2-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@H]2CC=CC[C@@H]2C(=O)N1CCOCC(F)(F)C(F)F |
| InChI | InChI=1S/C13H15F4NO3/c14-12(15)13(16,17)7-21-6-5-18-10(19)8-3-1-2-4-9(8)11(18)20/h1-2,8-9,12H,3-7H2/t8-,9-/m0/s1 |
| InChIKey | XYEVREFAWPTWBA-IUCAKERBSA-N |
| XLogP | 1.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|