C11H14F4N2O3 — CID 99858231
(7aS)-2-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 99858231) has the molecular formula C11H14F4N2O3 and a molecular weight of 298.24 g/mol. Its IUPAC name is (7aS)-2-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (7aS)-2-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 99858231 |
| Molecular Formula | C11H14F4N2O3 |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (7aS)-2-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | O=C1[C@@H]2CCCN2C(=O)N1CCOCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H14F4N2O3/c12-9(13)11(14,15)6-20-5-4-17-8(18)7-2-1-3-16(7)10(17)19/h7,9H,1-6H2/t7-/m0/s1 |
| InChIKey | WFAYBLITECXKBK-ZETCQYMHSA-N |
| XLogP | 1.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|