About [(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-methylimidazo[4,5-b]pyridine-6-carboxylate
[(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-methylimidazo[4,5-b]pyridine-6-carboxylate (PubChem CID 99858329) has the molecular formula C13H12N4O2S
and a molecular weight of 288.33 g/mol. Its IUPAC name is [(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-methylimidazo[4,5-b]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | [(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-methylimidazo[4,5-b]pyridine-6-carboxylate |
| PubChem CID | 99858329 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | [(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-methylimidazo[4,5-b]pyridine-6-carboxylate |
| SMILES | C[C@H](OC(=O)c1cnc2c(c1)ncn2C)c1nccs1 |
| InChI | InChI=1S/C13H12N4O2S/c1-8(12-14-3-4-20-12)19-13(18)9-5-10-11(15-6-9)17(2)7-16-10/h3-8H,1-2H3/t8-/m0/s1 |
| InChIKey | YCWKUMQVULXFFK-QMMMGPOBSA-N |
| XLogP | 2.34 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-methylimidazo[4,5-b]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-methylimidazo[4,5-b]pyridine-6-carboxylate?
The IUPAC name of [(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-methylimidazo[4,5-b]pyridine-6-carboxylate (CID 99858329) is [(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-methylimidazo[4,5-b]pyridine-6-carboxylate.
What is the SMILES notation for [(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-methylimidazo[4,5-b]pyridine-6-carboxylate?
The canonical SMILES for [(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-methylimidazo[4,5-b]pyridine-6-carboxylate is C[C@H](OC(=O)c1cnc2c(c1)ncn2C)c1nccs1.
What is the InChIKey of [(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-methylimidazo[4,5-b]pyridine-6-carboxylate?
The InChIKey is YCWKUMQVULXFFK-QMMMGPOBSA-N. The full InChI is InChI=1S/C13H12N4O2S/c1-8(12-14-3-4-20-12)19-13(18)9-5-10-11(15-6-9)17(2)7-16-10/h3-8H,1-2H3/t8-/m0/s1.
What are the key properties of [(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-methylimidazo[4,5-b]pyridine-6-carboxylate?
[(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-methylimidazo[4,5-b]pyridine-6-carboxylate has a molecular weight of 288.33 g/mol, XLogP of 2.34, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-(1,3-thiazol-2-yl)ethyl] 3-methylimidazo[4,5-b]pyridine-6-carboxylate is sourced from PubChem (CID 99858329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).