C16H22F2N2O3 — CID 99858558
1-[2-[2-(difluoromethoxy)phenyl]ethyl]-3-[(1S,2R)-2-hydroxycyclohexyl]urea (PubChem CID 99858558) has the molecular formula C16H22F2N2O3 and a molecular weight of 328.36 g/mol. Its IUPAC name is 1-[2-[2-(difluoromethoxy)phenyl]ethyl]-3-[(1S,2R)-2-hydroxycyclohexyl]urea.
| Compound Name | 1-[2-[2-(difluoromethoxy)phenyl]ethyl]-3-[(1S,2R)-2-hydroxycyclohexyl]urea |
|---|---|
| PubChem CID | 99858558 |
| Molecular Formula | C16H22F2N2O3 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 1-[2-[2-(difluoromethoxy)phenyl]ethyl]-3-[(1S,2R)-2-hydroxycyclohexyl]urea |
| SMILES | O=C(NCCc1ccccc1OC(F)F)N[C@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C16H22F2N2O3/c17-15(18)23-14-8-4-1-5-11(14)9-10-19-16(22)20-12-6-2-3-7-13(12)21/h1,4-5,8,12-13,15,21H,2-3,6-7,9-10H2,(H2,19,20,22)/t12-,13+/m0/s1 |
| InChIKey | FYMQRXIIABAKLR-QWHCGFSZSA-N |
| XLogP | 2.43 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |