About (2S)-1-acetyl-N-[(1R,2S)-2-ethylsulfanylcyclopentyl]pyrrolidine-2-carboxamide
(2S)-1-acetyl-N-[(1R,2S)-2-ethylsulfanylcyclopentyl]pyrrolidine-2-carboxamide (PubChem CID 99859057) has the molecular formula C14H24N2O2S
and a molecular weight of 284.42 g/mol. Its IUPAC name is (2S)-1-acetyl-N-[(1R,2S)-2-ethylsulfanylcyclopentyl]pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-1-acetyl-N-[(1R,2S)-2-ethylsulfanylcyclopentyl]pyrrolidine-2-carboxamide |
| PubChem CID | 99859057 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (2S)-1-acetyl-N-[(1R,2S)-2-ethylsulfanylcyclopentyl]pyrrolidine-2-carboxamide |
| SMILES | CCS[C@H]1CCC[C@H]1NC(=O)[C@@H]1CCCN1C(C)=O |
| InChI | InChI=1S/C14H24N2O2S/c1-3-19-13-8-4-6-11(13)15-14(18)12-7-5-9-16(12)10(2)17/h11-13H,3-9H2,1-2H3,(H,15,18)/t11-,12+,13+/m1/s1 |
| InChIKey | NHANSSSZCNPWIT-AGIUHOORSA-N |
| XLogP | 1.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-1-acetyl-N-[(1R,2S)-2-ethylsulfanylcyclopentyl]pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-acetyl-N-[(1R,2S)-2-ethylsulfanylcyclopentyl]pyrrolidine-2-carboxamide?
The IUPAC name of (2S)-1-acetyl-N-[(1R,2S)-2-ethylsulfanylcyclopentyl]pyrrolidine-2-carboxamide (CID 99859057) is (2S)-1-acetyl-N-[(1R,2S)-2-ethylsulfanylcyclopentyl]pyrrolidine-2-carboxamide.
What is the SMILES notation for (2S)-1-acetyl-N-[(1R,2S)-2-ethylsulfanylcyclopentyl]pyrrolidine-2-carboxamide?
The canonical SMILES for (2S)-1-acetyl-N-[(1R,2S)-2-ethylsulfanylcyclopentyl]pyrrolidine-2-carboxamide is CCS[C@H]1CCC[C@H]1NC(=O)[C@@H]1CCCN1C(C)=O.
What is the InChIKey of (2S)-1-acetyl-N-[(1R,2S)-2-ethylsulfanylcyclopentyl]pyrrolidine-2-carboxamide?
The InChIKey is NHANSSSZCNPWIT-AGIUHOORSA-N. The full InChI is InChI=1S/C14H24N2O2S/c1-3-19-13-8-4-6-11(13)15-14(18)12-7-5-9-16(12)10(2)17/h11-13H,3-9H2,1-2H3,(H,15,18)/t11-,12+,13+/m1/s1.
What are the key properties of (2S)-1-acetyl-N-[(1R,2S)-2-ethylsulfanylcyclopentyl]pyrrolidine-2-carboxamide?
(2S)-1-acetyl-N-[(1R,2S)-2-ethylsulfanylcyclopentyl]pyrrolidine-2-carboxamide has a molecular weight of 284.42 g/mol, XLogP of 1.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-acetyl-N-[(1R,2S)-2-ethylsulfanylcyclopentyl]pyrrolidine-2-carboxamide is sourced from PubChem (CID 99859057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).