About N-tert-butyl-2-[(4,4-dimethylcyclohexyl)sulfonylamino]acetamide
N-tert-butyl-2-[(4,4-dimethylcyclohexyl)sulfonylamino]acetamide (PubChem CID 99859346) has the molecular formula C14H28N2O3S
and a molecular weight of 304.46 g/mol. Its IUPAC name is N-tert-butyl-2-[(4,4-dimethylcyclohexyl)sulfonylamino]acetamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-[(4,4-dimethylcyclohexyl)sulfonylamino]acetamide |
| PubChem CID | 99859346 |
| Molecular Formula | C14H28N2O3S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-tert-butyl-2-[(4,4-dimethylcyclohexyl)sulfonylamino]acetamide |
| SMILES | CC1(C)CCC(S(=O)(=O)NCC(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H28N2O3S/c1-13(2,3)16-12(17)10-15-20(18,19)11-6-8-14(4,5)9-7-11/h11,15H,6-10H2,1-5H3,(H,16,17) |
| InChIKey | RYJFXXXTWDZHLE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-2-[(4,4-dimethylcyclohexyl)sulfonylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-[(4,4-dimethylcyclohexyl)sulfonylamino]acetamide?
The IUPAC name of N-tert-butyl-2-[(4,4-dimethylcyclohexyl)sulfonylamino]acetamide (CID 99859346) is N-tert-butyl-2-[(4,4-dimethylcyclohexyl)sulfonylamino]acetamide.
What is the SMILES notation for N-tert-butyl-2-[(4,4-dimethylcyclohexyl)sulfonylamino]acetamide?
The canonical SMILES for N-tert-butyl-2-[(4,4-dimethylcyclohexyl)sulfonylamino]acetamide is CC1(C)CCC(S(=O)(=O)NCC(=O)NC(C)(C)C)CC1.
What is the InChIKey of N-tert-butyl-2-[(4,4-dimethylcyclohexyl)sulfonylamino]acetamide?
The InChIKey is RYJFXXXTWDZHLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O3S/c1-13(2,3)16-12(17)10-15-20(18,19)11-6-8-14(4,5)9-7-11/h11,15H,6-10H2,1-5H3,(H,16,17).
What are the key properties of N-tert-butyl-2-[(4,4-dimethylcyclohexyl)sulfonylamino]acetamide?
N-tert-butyl-2-[(4,4-dimethylcyclohexyl)sulfonylamino]acetamide has a molecular weight of 304.46 g/mol, XLogP of 1.79, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-[(4,4-dimethylcyclohexyl)sulfonylamino]acetamide is sourced from PubChem (CID 99859346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).