C10H13F4NO — CID 99859433
2-[(1S)-cyclopent-2-en-1-yl]-N-(2,2,3,3-tetrafluoropropyl)acetamide (PubChem CID 99859433) has the molecular formula C10H13F4NO and a molecular weight of 239.21 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-N-(2,2,3,3-tetrafluoropropyl)acetamide.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-(2,2,3,3-tetrafluoropropyl)acetamide |
|---|---|
| PubChem CID | 99859433 |
| Molecular Formula | C10H13F4NO |
| Molecular Weight | 239.21 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-(2,2,3,3-tetrafluoropropyl)acetamide |
| SMILES | O=C(C[C@H]1C=CCC1)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H13F4NO/c11-9(12)10(13,14)6-15-8(16)5-7-3-1-2-4-7/h1,3,7,9H,2,4-6H2,(H,15,16)/t7-/m0/s1 |
| InChIKey | UHTVBMSQNKHTTE-ZETCQYMHSA-N |
| XLogP | 2.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|