C19H36N2O4Si — CID 99864417
tert-butyl N-[(1R,6R,8aS)-1-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-6-yl]carbamate (PubChem CID 99864417) has the molecular formula C19H36N2O4Si and a molecular weight of 384.59 g/mol. Its IUPAC name is tert-butyl N-[(1R,6R,8aS)-1-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-6-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,6R,8aS)-1-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-6-yl]carbamate |
|---|---|
| PubChem CID | 99864417 |
| Molecular Formula | C19H36N2O4Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | tert-butyl N-[(1R,6R,8aS)-1-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)CCN2C1=O |
| InChI | InChI=1S/C19H36N2O4Si/c1-18(2,3)24-17(23)20-13-9-10-14-15(11-12-21(14)16(13)22)25-26(7,8)19(4,5)6/h13-15H,9-12H2,1-8H3,(H,20,23)/t13-,14+,15-/m1/s1 |
| InChIKey | JKXONINNQVGXEG-QLFBSQMISA-N |
| XLogP | 3.66 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|