C26H47N5O6Si2 — CID 99865154
N-[(4S,5R)-9-[(6aR,8R,9R,9aS)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4,5-dihydropurin-6-yl]-2-methylpropanamide (PubChem CID 99865154) has the molecular formula C26H47N5O6Si2 and a molecular weight of 581.86 g/mol. Its IUPAC name is N-[(4S,5R)-9-[(6aR,8R,9R,9aS)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4,5-dihydropurin-6-yl]-2-methylpropanamide.
| Compound Name | N-[(4S,5R)-9-[(6aR,8R,9R,9aS)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4,5-dihydropurin-6-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 99865154 |
| Molecular Formula | C26H47N5O6Si2 |
| Molecular Weight | 581.86 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | N-[(4S,5R)-9-[(6aR,8R,9R,9aS)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4,5-dihydropurin-6-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC1=NC=N[C@@H]2[C@H]1N=CN2[C@@H]1O[C@@H]2CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C26H47N5O6Si2/c1-14(2)25(33)30-23-20-24(28-12-27-23)31(13-29-20)26-21(32)22-19(35-26)11-34-38(15(3)4,16(5)6)37-39(36-22,17(7)8)18(9)10/h12-22,24,26,32H,11H2,1-10H3,(H,27,28,30,33)/t19-,20+,21-,22-,24+,26-/m1/s1 |
| InChIKey | AJICZMCECPOMNS-UBFXQTCYSA-N |
| XLogP | 3.28 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.86 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|